C22H18N4O6 — CID 135957408
N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(3-nitrobenzoyl)amino]benzamide (PubChem CID 135957408) has the molecular formula C22H18N4O6 and a molecular weight of 434.41 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(3-nitrobenzoyl)amino]benzamide.
| Compound Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(3-nitrobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 135957408 |
| Molecular Formula | C22H18N4O6 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | N-[(E)-(2-hydroxy-5-methoxyphenyl)methylideneamino]-3-[(3-nitrobenzoyl)amino]benzamide |
| SMILES | COc1ccc(O)c(/C=N/NC(=O)c2cccc(NC(=O)c3cccc([N+](=O)[O-])c3)c2)c1 |
| InChI | InChI=1S/C22H18N4O6/c1-32-19-8-9-20(27)16(12-19)13-23-25-22(29)14-4-2-6-17(10-14)24-21(28)15-5-3-7-18(11-15)26(30)31/h2-13,27H,1H3,(H,24,28)(H,25,29)/b23-13+ |
| InChIKey | CWXUGQJUZQOQKC-YDZHTSKRSA-N |
| XLogP | 3.33 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|