C24H22N4O7 — CID 171135919
3-nitro-N-[4-[[(3,4,5-trimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide (PubChem CID 171135919) has the molecular formula C24H22N4O7 and a molecular weight of 478.46 g/mol. Its IUPAC name is 3-nitro-N-[4-[[(3,4,5-trimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide.
| Compound Name | 3-nitro-N-[4-[[(3,4,5-trimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 171135919 |
| Molecular Formula | C24H22N4O7 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 3-nitro-N-[4-[[(3,4,5-trimethoxyphenyl)methylideneamino]carbamoyl]phenyl]benzamide |
| SMILES | COc1cc(C=NNC(=O)c2ccc(NC(=O)c3cccc([N+](=O)[O-])c3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O7/c1-33-20-11-15(12-21(34-2)22(20)35-3)14-25-27-24(30)16-7-9-18(10-8-16)26-23(29)17-5-4-6-19(13-17)28(31)32/h4-14H,1-3H3,(H,26,29)(H,27,30) |
| InChIKey | OTFIFYKNLRXMMP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 141.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|