C17H16N4O7 — CID 110506741
N-[(E)-(3-ethoxy-4-methoxy-5-nitrophenyl)methylideneamino]-3-nitrobenzamide (PubChem CID 110506741) has the molecular formula C17H16N4O7 and a molecular weight of 388.34 g/mol. Its IUPAC name is N-[(E)-(3-ethoxy-4-methoxy-5-nitrophenyl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(E)-(3-ethoxy-4-methoxy-5-nitrophenyl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 110506741 |
| Molecular Formula | C17H16N4O7 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | N-[(E)-(3-ethoxy-4-methoxy-5-nitrophenyl)methylideneamino]-3-nitrobenzamide |
| SMILES | CCOc1cc(/C=N/NC(=O)c2cccc([N+](=O)[O-])c2)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C17H16N4O7/c1-3-28-15-8-11(7-14(21(25)26)16(15)27-2)10-18-19-17(22)12-5-4-6-13(9-12)20(23)24/h4-10H,3H2,1-2H3,(H,19,22)/b18-10+ |
| InChIKey | IPLUBWICUJYLCK-VCHYOVAHSA-N |
| XLogP | 2.67 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|