C19H21N3O5 — CID 9016103
N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]-3-nitrobenzamide (PubChem CID 9016103) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 9016103 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]-3-nitrobenzamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)cc1OCC |
| InChI | InChI=1S/C19H21N3O5/c1-3-10-27-17-9-8-14(11-18(17)26-4-2)13-20-21-19(23)15-6-5-7-16(12-15)22(24)25/h5-9,11-13H,3-4,10H2,1-2H3,(H,21,23)/b20-13- |
| InChIKey | ZNOBQHALKWCZBC-MOSHPQCFSA-N |
| XLogP | 3.55 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|