C19H23N3O3 — CID 9071275
4-amino-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide (PubChem CID 9071275) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-amino-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 9071275 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 4-amino-N-[(Z)-(3-ethoxy-4-propoxyphenyl)methylideneamino]benzamide |
| SMILES | CCCOc1ccc(/C=N\NC(=O)c2ccc(N)cc2)cc1OCC |
| InChI | InChI=1S/C19H23N3O3/c1-3-11-25-17-10-5-14(12-18(17)24-4-2)13-21-22-19(23)15-6-8-16(20)9-7-15/h5-10,12-13H,3-4,11,20H2,1-2H3,(H,22,23)/b21-13- |
| InChIKey | YLUQVVLDCXVHOH-BKUYFWCQSA-N |
| XLogP | 3.22 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|