C23H28N2O6 — CID 92659149
ethyl 2-[2-ethoxy-4-[(Z)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 92659149) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is ethyl 2-[2-ethoxy-4-[(Z)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-ethoxy-4-[(Z)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 92659149 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | ethyl 2-[2-ethoxy-4-[(Z)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCCOc1ccc(C(=O)N/N=C\c2ccc(OCC(=O)OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C23H28N2O6/c1-4-13-30-19-10-8-18(9-11-19)23(27)25-24-15-17-7-12-20(21(14-17)28-5-2)31-16-22(26)29-6-3/h7-12,14-15H,4-6,13,16H2,1-3H3,(H,25,27)/b24-15- |
| InChIKey | WAJDJUZVWHPENO-IWIPYMOSSA-N |
| XLogP | 3.58 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|