C20H22N2O5 — CID 133169409
methyl 2-[4-[(E)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 133169409) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 133169409 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | methyl 2-[4-[(E)-[(4-propoxybenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCCOc1ccc(C(=O)N/N=C/c2ccc(OCC(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-3-12-26-17-10-6-16(7-11-17)20(24)22-21-13-15-4-8-18(9-5-15)27-14-19(23)25-2/h4-11,13H,3,12,14H2,1-2H3,(H,22,24)/b21-13+ |
| InChIKey | JAHVSVZXFPSATO-FYJGNVAPSA-N |
| XLogP | 2.79 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|