C25H34N2O4 — CID 110509384
N-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-4-hydroxybenzamide (PubChem CID 110509384) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-4-hydroxybenzamide.
| Compound Name | N-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-4-hydroxybenzamide |
|---|---|
| PubChem CID | 110509384 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]-4-hydroxybenzamide |
| SMILES | CCCCCCCCCOc1ccc(/C=N\NC(=O)c2ccc(O)cc2)cc1OCC |
| InChI | InChI=1S/C25H34N2O4/c1-3-5-6-7-8-9-10-17-31-23-16-11-20(18-24(23)30-4-2)19-26-27-25(29)21-12-14-22(28)15-13-21/h11-16,18-19,28H,3-10,17H2,1-2H3,(H,27,29)/b26-19- |
| InChIKey | MZVITPAJJYPNHV-XHPQRKPJSA-N |
| XLogP | 5.68 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|