C19H31N3O3 — CID 110535880
[(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]urea (PubChem CID 110535880) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is [(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]urea.
| Compound Name | [(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]urea |
|---|---|
| PubChem CID | 110535880 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | [(Z)-(3-ethoxy-4-nonoxyphenyl)methylideneamino]urea |
| SMILES | CCCCCCCCCOc1ccc(/C=N\NC(N)=O)cc1OCC |
| InChI | InChI=1S/C19H31N3O3/c1-3-5-6-7-8-9-10-13-25-17-12-11-16(14-18(17)24-4-2)15-21-22-19(20)23/h11-12,14-15H,3-10,13H2,1-2H3,(H3,20,22,23)/b21-15- |
| InChIKey | TXAGHMDVTFACHR-QNGOZBTKSA-N |
| XLogP | 4.22 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|