C22H27N5O6 — CID 19655720
2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]acetamide (PubChem CID 19655720) has the molecular formula C22H27N5O6 and a molecular weight of 457.49 g/mol. Its IUPAC name is 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 19655720 |
| Molecular Formula | C22H27N5O6 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 2-[4-[(E)-(carbamoylhydrazinylidene)methyl]-2-methoxyphenoxy]-N-[(E)-(3,4-diethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCOc1ccc(/C=N/NC(=O)COc2ccc(/C=N/NC(N)=O)cc2OC)cc1OCC |
| InChI | InChI=1S/C22H27N5O6/c1-4-31-18-9-7-16(11-20(18)32-5-2)12-24-26-21(28)14-33-17-8-6-15(10-19(17)30-3)13-25-27-22(23)29/h6-13H,4-5,14H2,1-3H3,(H,26,28)(H3,23,27,29)/b24-12+,25-13+ |
| InChIKey | PCOZEMVIWFUALC-DWGHPKEWSA-N |
| XLogP | 2.02 |
| TPSA | 145.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|