C24H30N4O6 — CID 6018005
N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]butanediamide (PubChem CID 6018005) has the molecular formula C24H30N4O6 and a molecular weight of 470.53 g/mol. Its IUPAC name is N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]butanediamide.
| Compound Name | N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]butanediamide |
|---|---|
| PubChem CID | 6018005 |
| Molecular Formula | C24H30N4O6 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | N,N'-bis[(Z)-(4-ethoxy-3-methoxyphenyl)methylideneamino]butanediamide |
| SMILES | CCOc1ccc(/C=N\NC(=O)CCC(=O)N/N=C\c2ccc(OCC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H30N4O6/c1-5-33-19-9-7-17(13-21(19)31-3)15-25-27-23(29)11-12-24(30)28-26-16-18-8-10-20(34-6-2)22(14-18)32-4/h7-10,13-16H,5-6,11-12H2,1-4H3,(H,27,29)(H,28,30)/b25-15-,26-16- |
| InChIKey | IHDRXWSUURQEPM-YXHOTNNGSA-N |
| XLogP | 2.88 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|