C14H20N2O3 — CID 5381106
N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pentanamide (PubChem CID 5381106) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pentanamide.
| Compound Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 5381106 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[(Z)-(3,4-dimethoxyphenyl)methylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C\c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H20N2O3/c1-4-5-6-14(17)16-15-10-11-7-8-12(18-2)13(9-11)19-3/h7-10H,4-6H2,1-3H3,(H,16,17)/b15-10- |
| InChIKey | OGDVUZIBIBXCDI-GDNBJRDFSA-N |
| XLogP | 2.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|