C15H22N2O4 — CID 25004847
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-4-hydroxyhexanamide (PubChem CID 25004847) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-4-hydroxyhexanamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-4-hydroxyhexanamide |
|---|---|
| PubChem CID | 25004847 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-4-hydroxyhexanamide |
| SMILES | CCC(O)CCC(=O)N/N=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-4-12(18)6-8-15(19)17-16-10-11-5-7-13(20-2)14(9-11)21-3/h5,7,9-10,12,18H,4,6,8H2,1-3H3,(H,17,19)/b16-10+ |
| InChIKey | WXIZGSXALDOMNQ-MHWRWJLKSA-N |
| XLogP | 1.71 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|