C17H26N4O3 — CID 6893322
N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methylpiperazin-1-yl)propanamide (PubChem CID 6893322) has the molecular formula C17H26N4O3 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methylpiperazin-1-yl)propanamide.
| Compound Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methylpiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 6893322 |
| Molecular Formula | C17H26N4O3 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | N-[(E)-(3,4-dimethoxyphenyl)methylideneamino]-3-(4-methylpiperazin-1-yl)propanamide |
| SMILES | COc1ccc(/C=N/NC(=O)CCN2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C17H26N4O3/c1-20-8-10-21(11-9-20)7-6-17(22)19-18-13-14-4-5-15(23-2)16(12-14)24-3/h4-5,12-13H,6-11H2,1-3H3,(H,19,22)/b18-13+ |
| InChIKey | YWFZKXGTIKXWQR-QGOAFFKASA-N |
| XLogP | 0.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|