C30H36N4O4 — CID 3393438
3-(4-benzhydrylpiperazin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]propanamide (PubChem CID 3393438) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 3393438 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(3,4,5-trimethoxyphenyl)methylideneamino]propanamide |
| SMILES | COc1cc(C=NNC(=O)CCN2CCN(C(c3ccccc3)c3ccccc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N4O4/c1-36-26-20-23(21-27(37-2)30(26)38-3)22-31-32-28(35)14-15-33-16-18-34(19-17-33)29(24-10-6-4-7-11-24)25-12-8-5-9-13-25/h4-13,20-22,29H,14-19H2,1-3H3,(H,32,35) |
| InChIKey | DLZUSBDETVAINU-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|