C27H29BrN4O2 — CID 135909189
3-(4-benzhydrylpiperazin-1-yl)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide (PubChem CID 135909189) has the molecular formula C27H29BrN4O2 and a molecular weight of 521.46 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 135909189 |
| Molecular Formula | C27H29BrN4O2 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(Z)-(5-bromo-2-hydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCN1CCN(C(c2ccccc2)c2ccccc2)CC1)N/N=C\c1cc(Br)ccc1O |
| InChI | InChI=1S/C27H29BrN4O2/c28-24-11-12-25(33)23(19-24)20-29-30-26(34)13-14-31-15-17-32(18-16-31)27(21-7-3-1-4-8-21)22-9-5-2-6-10-22/h1-12,19-20,27,33H,13-18H2,(H,30,34)/b29-20- |
| InChIKey | PMBUAMQZQGNRAA-BRPDVVIDSA-N |
| XLogP | 4.40 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|