C41H39N5O — CID 146025202
3-(4-benzhydrylpiperazin-1-yl)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]propanamide (PubChem CID 146025202) has the molecular formula C41H39N5O and a molecular weight of 617.80 g/mol. Its IUPAC name is 3-(4-benzhydrylpiperazin-1-yl)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]propanamide.
| Compound Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 146025202 |
| Molecular Formula | C41H39N5O |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.32 |
| IUPAC Name | 3-(4-benzhydrylpiperazin-1-yl)-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]propanamide |
| SMILES | O=C(CCN1CCN(C(c2ccccc2)c2ccccc2)CC1)N/N=C/c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C41H39N5O/c47-39(25-26-44-27-29-45(30-28-44)40(32-15-5-1-6-16-32)33-17-7-2-8-18-33)43-42-31-37-36-23-13-14-24-38(36)46(35-21-11-4-12-22-35)41(37)34-19-9-3-10-20-34/h1-24,31,40H,25-30H2,(H,43,47)/b42-31+ |
| InChIKey | IHZCTNKBOMHWCE-FEMONOMJSA-N |
| XLogP | 7.54 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|