C28H23N4O+ — CID 146021708
N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide (PubChem CID 146021708) has the molecular formula C28H23N4O+ and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide.
| Compound Name | N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
|---|---|
| PubChem CID | 146021708 |
| Molecular Formula | C28H23N4O+ |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]-2-pyridin-1-ium-1-ylacetamide |
| SMILES | O=C(C[n+]1ccccc1)N/N=C/c1c(-c2ccccc2)n(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C28H22N4O/c33-27(21-31-18-10-3-11-19-31)30-29-20-25-24-16-8-9-17-26(24)32(23-14-6-2-7-15-23)28(25)22-12-4-1-5-13-22/h1-20H,21H2/p+1/b29-20+ |
| InChIKey | YXWOIYXEYVLHBI-ZTKZIYFRSA-O |
| XLogP | 4.74 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|