C28H23N3O2 — CID 2308479
N-[(1,2-diphenylindol-3-yl)methylideneamino]-2,5-dimethylfuran-3-carboxamide (PubChem CID 2308479) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[(1,2-diphenylindol-3-yl)methylideneamino]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[(1,2-diphenylindol-3-yl)methylideneamino]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 2308479 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[(1,2-diphenylindol-3-yl)methylideneamino]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NN=Cc2c(-c3ccccc3)n(-c3ccccc3)c3ccccc23)c(C)o1 |
| InChI | InChI=1S/C28H23N3O2/c1-19-17-24(20(2)33-19)28(32)30-29-18-25-23-15-9-10-16-26(23)31(22-13-7-4-8-14-22)27(25)21-11-5-3-6-12-21/h3-18H,1-2H3,(H,30,32) |
| InChIKey | QBLHUORBQWWRDP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 59.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|