C36H30N4O3S — CID 6902807
3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]benzamide (PubChem CID 6902807) has the molecular formula C36H30N4O3S and a molecular weight of 598.73 g/mol. Its IUPAC name is 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]benzamide.
| Compound Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 6902807 |
| Molecular Formula | C36H30N4O3S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 3-[(2,4-dimethylphenyl)sulfamoyl]-N-[(E)-(1,2-diphenylindol-3-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)N/N=C/c3c(-c4ccccc4)n(-c4ccccc4)c4ccccc34)c2)c(C)c1 |
| InChI | InChI=1S/C36H30N4O3S/c1-25-20-21-33(26(2)22-25)39-44(42,43)30-17-11-14-28(23-30)36(41)38-37-24-32-31-18-9-10-19-34(31)40(29-15-7-4-8-16-29)35(32)27-12-5-3-6-13-27/h3-24,39H,1-2H3,(H,38,41)/b37-24+ |
| InChIKey | DAWLMXQMZRGUCD-HWLOXFRGSA-N |
| XLogP | 7.48 |
| TPSA | 92.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|