C29H30N6O4S — CID 3256527
3-[(2-methoxyphenyl)sulfamoyl]-N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]benzamide (PubChem CID 3256527) has the molecular formula C29H30N6O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)sulfamoyl]-N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]benzamide.
| Compound Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 3256527 |
| Molecular Formula | C29H30N6O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 3-[(2-methoxyphenyl)sulfamoyl]-N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]benzamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)NN=Cc2c(C)nn(-c3ccccc3)c2N2CCCC2)c1 |
| InChI | InChI=1S/C29H30N6O4S/c1-21-25(29(34-17-8-9-18-34)35(32-21)23-12-4-3-5-13-23)20-30-31-28(36)22-11-10-14-24(19-22)40(37,38)33-26-15-6-7-16-27(26)39-2/h3-7,10-16,19-20,33H,8-9,17-18H2,1-2H3,(H,31,36) |
| InChIKey | RPXGZCCOQIIMPO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|