C27H32N6O3S — CID 5035048
N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 5035048) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 5035048 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | N-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2)c1C=NNC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C27H32N6O3S/c1-21-25(27(31-15-8-9-16-31)33(30-21)23-12-4-2-5-13-23)20-28-29-26(34)22-11-10-14-24(19-22)37(35,36)32-17-6-3-7-18-32/h2,4-5,10-14,19-20H,3,6-9,15-18H2,1H3,(H,29,34) |
| InChIKey | FNYUWQUODQYKFA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|