C24H27N7O3 — CID 6012797
4-(ethylamino)-N-[(Z)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-nitrobenzamide (PubChem CID 6012797) has the molecular formula C24H27N7O3 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4-(ethylamino)-N-[(Z)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-nitrobenzamide.
| Compound Name | 4-(ethylamino)-N-[(Z)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 6012797 |
| Molecular Formula | C24H27N7O3 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | 4-(ethylamino)-N-[(Z)-(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylideneamino]-3-nitrobenzamide |
| SMILES | CCNc1ccc(C(=O)N/N=C\c2c(C)nn(-c3ccccc3)c2N2CCCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27N7O3/c1-3-25-21-12-11-18(15-22(21)31(33)34)23(32)27-26-16-20-17(2)28-30(19-9-5-4-6-10-19)24(20)29-13-7-8-14-29/h4-6,9-12,15-16,25H,3,7-8,13-14H2,1-2H3,(H,27,32)/b26-16- |
| InChIKey | YYEBAWNWKVJNSQ-QQXSKIMKSA-N |
| XLogP | 3.88 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|