C21H23N7O4S — CID 6254805
4-[(2Z)-2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 6254805) has the molecular formula C21H23N7O4S and a molecular weight of 469.53 g/mol. Its IUPAC name is 4-[(2Z)-2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2Z)-2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 6254805 |
| Molecular Formula | C21H23N7O4S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 4-[(2Z)-2-[(3-methyl-1-phenyl-5-pyrrolidin-1-ylpyrazol-4-yl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1nn(-c2ccccc2)c(N2CCCC2)c1/C=N\Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N7O4S/c1-15-18(14-23-24-19-10-9-17(33(22,31)32)13-20(19)28(29)30)21(26-11-5-6-12-26)27(25-15)16-7-3-2-4-8-16/h2-4,7-10,13-14,24H,5-6,11-12H2,1H3,(H2,22,31,32)/b23-14- |
| InChIKey | XXJIVWYQEHPNLP-UCQKPKSFSA-N |
| XLogP | 2.78 |
| TPSA | 148.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|