C14H12N4O6S — CID 6303781
2-[(Z)-[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]benzoic acid (PubChem CID 6303781) has the molecular formula C14H12N4O6S and a molecular weight of 364.34 g/mol. Its IUPAC name is 2-[(Z)-[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]benzoic acid.
| Compound Name | 2-[(Z)-[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 6303781 |
| Molecular Formula | C14H12N4O6S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-[(Z)-[(2-nitro-4-sulfamoylphenyl)hydrazinylidene]methyl]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(N/N=C\c2ccccc2C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N4O6S/c15-25(23,24)10-5-6-12(13(7-10)18(21)22)17-16-8-9-3-1-2-4-11(9)14(19)20/h1-8,17H,(H,19,20)(H2,15,23,24)/b16-8- |
| InChIKey | WYWALDPPNQYKEC-PXNMLYILSA-N |
| XLogP | 1.39 |
| TPSA | 164.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|