C20H16N4O8S — CID 135881855
2-[[4-[(2Z)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 135881855) has the molecular formula C20H16N4O8S and a molecular weight of 472.44 g/mol. Its IUPAC name is 2-[[4-[(2Z)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(2Z)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 135881855 |
| Molecular Formula | C20H16N4O8S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2-[[4-[(2Z)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NS(=O)(=O)c1ccc(N/N=C\c2cccc(O)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N4O8S/c25-18-7-3-4-12(19(18)26)11-21-22-16-9-8-13(10-17(16)24(29)30)33(31,32)23-15-6-2-1-5-14(15)20(27)28/h1-11,22-23,25-26H,(H,27,28)/b21-11- |
| InChIKey | GLBNFOIVRMZJKQ-NHDPSOOVSA-N |
| XLogP | 2.95 |
| TPSA | 191.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|