C22H22N4O7S — CID 135607771
4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 135607771) has the molecular formula C22H22N4O7S and a molecular weight of 486.51 g/mol. Its IUPAC name is 4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135607771 |
| Molecular Formula | C22H22N4O7S |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | CCOc1cccc(/C=N/Nc2ccc(S(=O)(=O)Nc3ccccc3OC)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H22N4O7S/c1-3-33-21-10-6-7-15(22(21)27)14-23-24-17-12-11-16(13-19(17)26(28)29)34(30,31)25-18-8-4-5-9-20(18)32-2/h4-14,24-25,27H,3H2,1-2H3/b23-14+ |
| InChIKey | DFHNFBRGUCBADY-OEAKJJBVSA-N |
| XLogP | 3.95 |
| TPSA | 152.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|