C20H18N4O7S — CID 135683885
4-[(2E)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide (PubChem CID 135683885) has the molecular formula C20H18N4O7S and a molecular weight of 458.45 g/mol. Its IUPAC name is 4-[(2E)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide.
| Compound Name | 4-[(2E)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135683885 |
| Molecular Formula | C20H18N4O7S |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 4-[(2E)-2-[(2,3-dihydroxyphenyl)methylidene]hydrazinyl]-N-(2-methoxyphenyl)-3-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc(N/N=C/c2cccc(O)c2O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N4O7S/c1-31-19-8-3-2-6-16(19)23-32(29,30)14-9-10-15(17(11-14)24(27)28)22-21-12-13-5-4-7-18(25)20(13)26/h2-12,22-23,25-26H,1H3/b21-12+ |
| InChIKey | VQPMUGNQLILXOK-CIAFOILYSA-N |
| XLogP | 3.26 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|