C22H20N4O8S — CID 135613890
2-[[4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid (PubChem CID 135613890) has the molecular formula C22H20N4O8S and a molecular weight of 500.49 g/mol. Its IUPAC name is 2-[[4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid.
| Compound Name | 2-[[4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 135613890 |
| Molecular Formula | C22H20N4O8S |
| Molecular Weight | 500.49 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 2-[[4-[(2E)-2-[(3-ethoxy-2-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrophenyl]sulfonylamino]benzoic acid |
| SMILES | CCOc1cccc(/C=N/Nc2ccc(S(=O)(=O)Nc3ccccc3C(=O)O)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C22H20N4O8S/c1-2-34-20-9-5-6-14(21(20)27)13-23-24-18-11-10-15(12-19(18)26(30)31)35(32,33)25-17-8-4-3-7-16(17)22(28)29/h3-13,24-25,27H,2H2,1H3,(H,28,29)/b23-13+ |
| InChIKey | YNLSHXXLIGTJNZ-YDZHTSKRSA-N |
| XLogP | 3.64 |
| TPSA | 180.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|