C23H22N4O7S — CID 6303778
2-[2-[(Z)-[[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 6303778) has the molecular formula C23H22N4O7S and a molecular weight of 498.52 g/mol. Its IUPAC name is 2-[2-[(Z)-[[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-[(Z)-[[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 6303778 |
| Molecular Formula | C23H22N4O7S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.12 |
| IUPAC Name | 2-[2-[(Z)-[[4-[(2,4-dimethylphenyl)sulfamoyl]-2-nitrophenyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N/N=C\c3ccccc3OCC(=O)O)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C23H22N4O7S/c1-15-7-9-19(16(2)11-15)26-35(32,33)18-8-10-20(21(12-18)27(30)31)25-24-13-17-5-3-4-6-22(17)34-14-23(28)29/h3-13,25-26H,14H2,1-2H3,(H,28,29)/b24-13- |
| InChIKey | KTRPQRRUSCXPIR-CFRMEGHHSA-N |
| XLogP | 3.92 |
| TPSA | 160.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|