C21H20N4O5S — CID 135659321
N-(2,4-dimethylphenyl)-4-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 135659321) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-4-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-(2,4-dimethylphenyl)-4-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 135659321 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | N-(2,4-dimethylphenyl)-4-[(2E)-2-[(4-hydroxyphenyl)methylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(N/N=C/c3ccc(O)cc3)c([N+](=O)[O-])c2)c(C)c1 |
| InChI | InChI=1S/C21H20N4O5S/c1-14-3-9-19(15(2)11-14)24-31(29,30)18-8-10-20(21(12-18)25(27)28)23-22-13-16-4-6-17(26)7-5-16/h3-13,23-24,26H,1-2H3/b22-13+ |
| InChIKey | RGEKJXGHDXTRSC-LPYMAVHISA-N |
| XLogP | 4.16 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|