C13H10N4O5 — CID 135442992
4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol (PubChem CID 135442992) has the molecular formula C13H10N4O5 and a molecular weight of 302.25 g/mol. Its IUPAC name is 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 135442992 |
| Molecular Formula | C13H10N4O5 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 4-[(E)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]phenol |
| SMILES | O=[N+]([O-])c1ccc(N/N=C/c2ccc(O)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H10N4O5/c18-11-4-1-9(2-5-11)8-14-15-12-6-3-10(16(19)20)7-13(12)17(21)22/h1-8,15,18H/b14-8+ |
| InChIKey | GQIVASLYJABIKA-RIYZIHGNSA-N |
| XLogP | 2.65 |
| TPSA | 130.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|