C15H14N4O7 — CID 3525992
4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol (PubChem CID 3525992) has the molecular formula C15H14N4O7 and a molecular weight of 362.30 g/mol. Its IUPAC name is 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 3525992 |
| Molecular Formula | C15H14N4O7 |
| Molecular Weight | 362.30 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2,6-dimethoxyphenol |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc(OC)c1O |
| InChI | InChI=1S/C15H14N4O7/c1-25-13-5-9(6-14(26-2)15(13)20)8-16-17-11-4-3-10(18(21)22)7-12(11)19(23)24/h3-8,17,20H,1-2H3 |
| InChIKey | PZQQJKVSPBSBCK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 149.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|