C16H14N4O7 — CID 4506105
[4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate (PubChem CID 4506105) has the molecular formula C16H14N4O7 and a molecular weight of 374.31 g/mol. Its IUPAC name is [4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 4506105 |
| Molecular Formula | C16H14N4O7 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [4-[[(2,4-dinitrophenyl)hydrazinylidene]methyl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1OC(C)=O |
| InChI | InChI=1S/C16H14N4O7/c1-10(21)27-15-6-3-11(7-16(15)26-2)9-17-18-13-5-4-12(19(22)23)8-14(13)20(24)25/h3-9,18H,1-2H3 |
| InChIKey | YUJVVIIATUFOBU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|