C16H16N4O7 — CID 6282029
2,4-dinitro-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]aniline (PubChem CID 6282029) has the molecular formula C16H16N4O7 and a molecular weight of 376.33 g/mol. Its IUPAC name is 2,4-dinitro-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]aniline |
|---|---|
| PubChem CID | 6282029 |
| Molecular Formula | C16H16N4O7 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2,4-dinitro-N-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]aniline |
| SMILES | COc1cc(OC)c(OC)cc1/C=N\Nc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H16N4O7/c1-25-14-8-16(27-3)15(26-2)6-10(14)9-17-18-12-5-4-11(19(21)22)7-13(12)20(23)24/h4-9,18H,1-3H3/b17-9- |
| InChIKey | NLBYFLYTNMKSDE-MFOYZWKCSA-N |
| XLogP | 2.97 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|