C23H27N5O5 — CID 50869773
N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2,4-dinitroaniline (PubChem CID 50869773) has the molecular formula C23H27N5O5 and a molecular weight of 453.50 g/mol. Its IUPAC name is N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2,4-dinitroaniline.
| Compound Name | N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2,4-dinitroaniline |
|---|---|
| PubChem CID | 50869773 |
| Molecular Formula | C23H27N5O5 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.20 |
| IUPAC Name | N-[(Z)-(7-methoxy-2,2,4-trimethyl-1-propylquinolin-6-yl)methylideneamino]-2,4-dinitroaniline |
| SMILES | CCCN1c2cc(OC)c(/C=N\Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C23H27N5O5/c1-6-9-26-20-12-22(33-5)16(10-18(20)15(2)13-23(26,3)4)14-24-25-19-8-7-17(27(29)30)11-21(19)28(31)32/h7-8,10-14,25H,6,9H2,1-5H3/b24-14- |
| InChIKey | FDJSPNLODWKHBA-OYKKKHCWSA-N |
| XLogP | 5.37 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|