C23H27N5O4 — CID 133170133
2,4-dinitro-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline (PubChem CID 133170133) has the molecular formula C23H27N5O4 and a molecular weight of 437.50 g/mol. Its IUPAC name is 2,4-dinitro-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | 2,4-dinitro-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 133170133 |
| Molecular Formula | C23H27N5O4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2,4-dinitro-N-[(E)-(2,2,4,7-tetramethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CC1=CC(C)(C)N(C(C)C)c2cc(C)c(/C=N/Nc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])cc21 |
| InChI | InChI=1S/C23H27N5O4/c1-14(2)26-21-9-15(3)17(10-19(21)16(4)12-23(26,5)6)13-24-25-20-8-7-18(27(29)30)11-22(20)28(31)32/h7-14,25H,1-6H3/b24-13+ |
| InChIKey | BQGMLCBEZSUTCO-ZMOGYAJESA-N |
| XLogP | 5.67 |
| TPSA | 113.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|