C22H27N5O2 — CID 50868447
3-nitro-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]pyridin-2-amine (PubChem CID 50868447) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-nitro-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]pyridin-2-amine.
| Compound Name | 3-nitro-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 50868447 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 3-nitro-N-[(Z)-(2,2,4,7-tetramethyl-1-propylquinolin-6-yl)methylideneamino]pyridin-2-amine |
| SMILES | CCCN1c2cc(C)c(/C=N\Nc3ncccc3[N+](=O)[O-])cc2C(C)=CC1(C)C |
| InChI | InChI=1S/C22H27N5O2/c1-6-10-26-20-11-15(2)17(12-18(20)16(3)13-22(26,4)5)14-24-25-21-19(27(28)29)8-7-9-23-21/h7-9,11-14H,6,10H2,1-5H3,(H,23,25)/b24-14- |
| InChIKey | NXUZBMVYXMZQLW-OYKKKHCWSA-N |
| XLogP | 5.16 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|