C21H25N3 — CID 50864633
N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline (PubChem CID 50864633) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 50864633 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]aniline |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N\Nc3ccccc3)cc21 |
| InChI | InChI=1S/C21H25N3/c1-15-11-20-19(16(2)13-21(3,4)24(20)5)12-17(15)14-22-23-18-9-7-6-8-10-18/h6-14,23H,1-5H3/b22-14- |
| InChIKey | SEQTXLKXIZPUOX-HMAPJEAMSA-N |
| XLogP | 5.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|