C20H23N3OS — CID 133170033
N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 133170033) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 133170033 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[(Z)-(1,2,2,4,7-pentamethylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CC1=CC(C)(C)N(C)c2cc(C)c(/C=N\NC(=O)c3cccs3)cc21 |
| InChI | InChI=1S/C20H23N3OS/c1-13-9-17-16(14(2)11-20(3,4)23(17)5)10-15(13)12-21-22-19(24)18-7-6-8-25-18/h6-12H,1-5H3,(H,22,24)/b21-12- |
| InChIKey | LFTATRMRVPYBPS-MTJSOVHGSA-N |
| XLogP | 4.45 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|