C21H25N3OS — CID 133169964
N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 133169964) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 133169964 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | CC1=CC(C)(C)N(C(C)C)c2ccc(/C=N\NC(=O)c3cccs3)cc21 |
| InChI | InChI=1S/C21H25N3OS/c1-14(2)24-18-9-8-16(11-17(18)15(3)12-21(24,4)5)13-22-23-20(25)19-7-6-10-26-19/h6-14H,1-5H3,(H,23,25)/b22-13- |
| InChIKey | ROTMLBSWHDUQRO-XKZIYDEJSA-N |
| XLogP | 4.92 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|