C24H27Cl2N3O2 — CID 133169976
2-(2,4-dichlorophenoxy)-N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]acetamide (PubChem CID 133169976) has the molecular formula C24H27Cl2N3O2 and a molecular weight of 460.41 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 133169976 |
| Molecular Formula | C24H27Cl2N3O2 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(Z)-(2,2,4-trimethyl-1-propan-2-ylquinolin-6-yl)methylideneamino]acetamide |
| SMILES | CC1=CC(C)(C)N(C(C)C)c2ccc(/C=N\NC(=O)COc3ccc(Cl)cc3Cl)cc21 |
| InChI | InChI=1S/C24H27Cl2N3O2/c1-15(2)29-21-8-6-17(10-19(21)16(3)12-24(29,4)5)13-27-28-23(30)14-31-22-9-7-18(25)11-20(22)26/h6-13,15H,14H2,1-5H3,(H,28,30)/b27-13- |
| InChIKey | SLYMIJBSASZHEE-WKIKZPBSSA-N |
| XLogP | 5.93 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|