C20H20Cl2N2O5 — CID 40988895
propan-2-yl 2-[4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 40988895) has the molecular formula C20H20Cl2N2O5 and a molecular weight of 439.30 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 40988895 |
| Molecular Formula | C20H20Cl2N2O5 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | propan-2-yl 2-[4-[[[2-(2,4-dichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(C=NNC(=O)COc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H20Cl2N2O5/c1-13(2)29-20(26)12-27-16-6-3-14(4-7-16)10-23-24-19(25)11-28-18-8-5-15(21)9-17(18)22/h3-10,13H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | BIWHNJFUQPPCTN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|