C24H19BrCl2N2O6 — CID 3661355
[4-[[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-(2,4-dichlorophenoxy)acetate (PubChem CID 3661355) has the molecular formula C24H19BrCl2N2O6 and a molecular weight of 582.23 g/mol. Its IUPAC name is [4-[[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-(2,4-dichlorophenoxy)acetate.
| Compound Name | [4-[[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-(2,4-dichlorophenoxy)acetate |
|---|---|
| PubChem CID | 3661355 |
| Molecular Formula | C24H19BrCl2N2O6 |
| Molecular Weight | 582.23 g/mol |
| Exact Mass | 579.98 |
| IUPAC Name | [4-[[[2-(4-bromo-2-methoxyphenoxy)acetyl]hydrazinylidene]methyl]phenyl] 2-(2,4-dichlorophenoxy)acetate |
| SMILES | COc1cc(Br)ccc1OCC(=O)NN=Cc1ccc(OC(=O)COc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H19BrCl2N2O6/c1-32-22-10-16(25)4-8-21(22)33-13-23(30)29-28-12-15-2-6-18(7-3-15)35-24(31)14-34-20-9-5-17(26)11-19(20)27/h2-12H,13-14H2,1H3,(H,29,30) |
| InChIKey | AVPNOCHAQZCWOT-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.23 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|