C20H19Cl3N2O5 — CID 40988837
propan-2-yl 2-[4-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 40988837) has the molecular formula C20H19Cl3N2O5 and a molecular weight of 473.74 g/mol. Its IUPAC name is propan-2-yl 2-[4-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | propan-2-yl 2-[4-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 40988837 |
| Molecular Formula | C20H19Cl3N2O5 |
| Molecular Weight | 473.74 g/mol |
| Exact Mass | 472.04 |
| IUPAC Name | propan-2-yl 2-[4-[(Z)-[[2-(2,3,5-trichlorophenoxy)acetyl]hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CC(C)OC(=O)COc1ccc(/C=N\NC(=O)COc2cc(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C20H19Cl3N2O5/c1-12(2)30-19(27)11-28-15-5-3-13(4-6-15)9-24-25-18(26)10-29-17-8-14(21)7-16(22)20(17)23/h3-9,12H,10-11H2,1-2H3,(H,25,26)/b24-9- |
| InChIKey | SRZKUPQYQROOTD-OPVMPGTRSA-N |
| XLogP | 4.51 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|