C13H8Cl3IN2O3 — CID 126006841
N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide (PubChem CID 126006841) has the molecular formula C13H8Cl3IN2O3 and a molecular weight of 473.48 g/mol. Its IUPAC name is N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 126006841 |
| Molecular Formula | C13H8Cl3IN2O3 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 471.86 |
| IUPAC Name | N-[(Z)-(5-iodofuran-2-yl)methylideneamino]-2-(2,3,5-trichlorophenoxy)acetamide |
| SMILES | O=C(COc1cc(Cl)cc(Cl)c1Cl)N/N=C\c1ccc(I)o1 |
| InChI | InChI=1S/C13H8Cl3IN2O3/c14-7-3-9(15)13(16)10(4-7)21-6-12(20)19-18-5-8-1-2-11(17)22-8/h1-5H,6H2,(H,19,20)/b18-5- |
| InChIKey | NAIJLOQIZSGSAT-DVZOWYKESA-N |
| XLogP | 4.37 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|