C20H15Cl3N2O4 — CID 50929978
N-[(Z)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(2,5-dichlorophenoxy)acetamide (PubChem CID 50929978) has the molecular formula C20H15Cl3N2O4 and a molecular weight of 453.71 g/mol. Its IUPAC name is N-[(Z)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(2,5-dichlorophenoxy)acetamide.
| Compound Name | N-[(Z)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 50929978 |
| Molecular Formula | C20H15Cl3N2O4 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | N-[(Z)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(2,5-dichlorophenoxy)acetamide |
| SMILES | COc1ccc(-c2ccc(/C=N\NC(=O)COc3cc(Cl)ccc3Cl)o2)cc1Cl |
| InChI | InChI=1S/C20H15Cl3N2O4/c1-27-18-6-2-12(8-16(18)23)17-7-4-14(29-17)10-24-25-20(26)11-28-19-9-13(21)3-5-15(19)22/h2-10H,11H2,1H3,(H,25,26)/b24-10- |
| InChIKey | HCVIDCMLTCCFMJ-VROXFSQNSA-N |
| XLogP | 5.44 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|