C21H19ClN2O4 — CID 5333657
N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(3-methylphenoxy)acetamide (PubChem CID 5333657) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 5333657 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[(E)-[5-(3-chloro-4-methoxyphenyl)furan-2-yl]methylideneamino]-2-(3-methylphenoxy)acetamide |
| SMILES | COc1ccc(-c2ccc(/C=N/NC(=O)COc3cccc(C)c3)o2)cc1Cl |
| InChI | InChI=1S/C21H19ClN2O4/c1-14-4-3-5-16(10-14)27-13-21(25)24-23-12-17-7-9-19(28-17)15-6-8-20(26-2)18(22)11-15/h3-12H,13H2,1-2H3,(H,24,25)/b23-12+ |
| InChIKey | AFCQQYDQPSXULM-FSJBWODESA-N |
| XLogP | 4.45 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|