C14H13N2NaO6S — CID 23670347
sodium 5-[(E)-[[2-(3-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 23670347) has the molecular formula C14H13N2NaO6S and a molecular weight of 360.32 g/mol. Its IUPAC name is sodium 5-[(E)-[[2-(3-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | sodium 5-[(E)-[[2-(3-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 23670347 |
| Molecular Formula | C14H13N2NaO6S |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | sodium 5-[(E)-[[2-(3-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | Cc1cccc(OCC(=O)N/N=C/c2ccc(S(=O)(=O)[O-])o2)c1.[Na+] |
| InChI | InChI=1S/C14H14N2O6S.Na/c1-10-3-2-4-11(7-10)21-9-13(17)16-15-8-12-5-6-14(22-12)23(18,19)20;/h2-8H,9H2,1H3,(H,16,17)(H,18,19,20);/q;+1/p-1/b15-8+; |
| InChIKey | MTGRJCXBOCLATI-TWNLEINFSA-M |
| XLogP | -1.97 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|