C14H12ClN2O6S- — CID 74259890
5-[[[2-(4-chloro-2-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate (PubChem CID 74259890) has the molecular formula C14H12ClN2O6S- and a molecular weight of 371.78 g/mol. Its IUPAC name is 5-[[[2-(4-chloro-2-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate.
| Compound Name | 5-[[[2-(4-chloro-2-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
|---|---|
| PubChem CID | 74259890 |
| Molecular Formula | C14H12ClN2O6S- |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | 5-[[[2-(4-chloro-2-methylphenoxy)acetyl]hydrazinylidene]methyl]furan-2-sulfonate |
| SMILES | Cc1cc(Cl)ccc1OCC(=O)NN=Cc1ccc(S(=O)(=O)[O-])o1 |
| InChI | InChI=1S/C14H13ClN2O6S/c1-9-6-10(15)2-4-12(9)22-8-13(18)17-16-7-11-3-5-14(23-11)24(19,20)21/h2-7H,8H2,1H3,(H,17,18)(H,19,20,21)/p-1 |
| InChIKey | FVQRGCZACMCWTJ-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|